tetramethyl benzene-1,2,3,4-tetracarboxylate
tetramethyl benzene-1,2,3,4-tetracarboxylate structure
|
Common Name | tetramethyl benzene-1,2,3,4-tetracarboxylate | ||
|---|---|---|---|---|
| CAS Number | 3451-02-3 | Molecular Weight | 310.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tetramethyl benzene-1,2,3,4-tetracarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14O8 |
|---|---|
| Molecular Weight | 310.25600 |
| Exact Mass | 310.06900 |
| PSA | 105.20000 |
| LogP | 0.83300 |
| InChIKey | QDJPGDCRLZYJGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(C(=O)OC)c1C(=O)OC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:476-73-3
CAS#:605-70-9
CAS#:5665-24-7
CAS#:5665-25-8
CAS#:67-56-1![8-methoxy-2,3-dihydrocyclopenta[a]naphthalen-1-one Structure](https://image.chemsrc.com/caspic/235/5670-11-1.png)
CAS#:5670-11-1
CAS#:121-46-0
CAS#:41895-84-5
CAS#:762-42-5
CAS#:74-88-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzene-1,2,3,4-tetracarboxylic acid tetramethyl ester |
| mellophanic acid tetramethyl ester |
| 1,2,3,4-Benzenetetracarboxylic acid,tetramethyl ester |
| 1,2,3,4-Benzoltetracarbonsaeure-tetramethylester |
| Benzol-1,2,3,4-tetracarbonsaeure-tetramethylester |
| Tetramethyl 1,2,3,4-benzenetetracarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of tetramethyl benzene-1,2,3,4-tetracarboxylate? |
| A: InChIKey of tetramethyl benzene-1,2,3,4-tetracarboxylate is QDJPGDCRLZYJGQ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of tetramethyl benzene-1,2,3,4-tetracarboxylate? |
| A: Polar surface area (PSA) of tetramethyl benzene-1,2,3,4-tetracarboxylate is 105.20000. |
| Q: What is the molecular weight of tetramethyl benzene-1,2,3,4-tetracarboxylate? |
| A: Molecular weight of tetramethyl benzene-1,2,3,4-tetracarboxylate is 310.25600. |
| Q: What are the upstream materials of tetramethyl benzene-1,2,3,4-tetracarboxylate? |
| A: Related upstream materials(CAS) of tetramethyl benzene-1,2,3,4-tetracarboxylate: 476-73-3;605-70-9;5665-24-7;5665-25-8;67-56-1;5670-11-1;121-46-0;41895-84-5;762-42-5;74-88-4. |
| Q: What is the SMILES notation of tetramethyl benzene-1,2,3,4-tetracarboxylate? |
| A: SMILES notation of tetramethyl benzene-1,2,3,4-tetracarboxylate is COC(=O)c1ccc(C(=O)OC)c(C(=O)OC)c1C(=O)OC. |
| Q: What is the molecular formula of tetramethyl benzene-1,2,3,4-tetracarboxylate? |
| A: Molecular formula of tetramethyl benzene-1,2,3,4-tetracarboxylate is C14H14O8. |
| Q: What is the CAS number of tetramethyl benzene-1,2,3,4-tetracarboxylate? |
| A: CAS number of tetramethyl benzene-1,2,3,4-tetracarboxylate is 3451-02-3. |
| Q: What is the Chinese name of 3451-02-3? |
| A: Chinese name of 3451-02-3 is 3451-02-3. |
| Q: What is the LogP of tetramethyl benzene-1,2,3,4-tetracarboxylate? |
| A: LogP of tetramethyl benzene-1,2,3,4-tetracarboxylate is 0.83300. |
| Q: What English synonyms does tetramethyl benzene-1,2,3,4-tetracarboxylate have? |
| A: English synonyms of tetramethyl benzene-1,2,3,4-tetracarboxylate: benzene-1,2,3,4-tetracarboxylic acid tetramethyl ester, mellophanic acid tetramethyl ester, 1,2,3,4-Benzenetetracarboxylic acid,tetramethyl ester, 1,2,3,4-Benzoltetracarbonsaeure-tetramethylester, Benzol-1,2,3,4-tetracarbonsaeure-tetramethylester, Tetramethyl 1,2,3,4-benzenetetracarboxylate. |