Methyl 3-(2,4-dichlorophenyl)-3-oxopropanoate structure
|
Common Name | Methyl 3-(2,4-dichlorophenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 56719-67-6 | Molecular Weight | 247.075 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 307.3±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.1±22.7 °C | |
| Name | methyl 3-(2,4-dichlorophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.3±27.0 °C at 760 mmHg |
| Molecular Formula | C10H8Cl2O3 |
| Molecular Weight | 247.075 |
| Flash Point | 125.1±22.7 °C |
| Exact Mass | 245.985046 |
| PSA | 43.37000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | FWNFVLUGKXPFTD-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)c1ccc(Cl)cc1Cl |
| HS Code | 2918300090 |
|---|
|
~66%
Methyl 3-(2,4-d... CAS#:56719-67-6 |
| Literature: Lapidus; Eliseev; Bondarenko; Sizan; Ostapenko; Beletskaya Synthesis, 2002 , # 3 p. 317 - 319 |
|
~%
Methyl 3-(2,4-d... CAS#:56719-67-6 |
| Literature: BIOENERGENIX Patent: US2012/277224 A1, 2012 ; Location in patent: Page/Page column 21 ; US 20120277224 A1 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl 3-(2,4-dichlorophenyl)-3-oxopropanoate |
| 2,4-Dichlor-benzoylessigsaeure-methylester |
| methyl 2,4-dichlorobenzoylacetate |
| Benzenepropanoic acid, 2,4-dichloro-β-oxo-, methyl ester |