(4-pentenyl)triphenylphosphonium bromide
(4-pentenyl)triphenylphosphonium bromide structure
|
Common Name | (4-pentenyl)triphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 56771-29-0 | Molecular Weight | 411.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24BrP | Melting Point | 194-196ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | pent-4-enyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 194-196ºC |
|---|---|
| Molecular Formula | C23H24BrP |
| Molecular Weight | 411.31400 |
| Exact Mass | 410.08000 |
| PSA | 13.59000 |
| LogP | 1.95070 |
| InChIKey | KANICXDUFCDRDS-UHFFFAOYSA-M |
| SMILES | C=CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~98%
(4-pentenyl)tri... CAS#:56771-29-0 |
| Literature: Chu, Qianli; Brahmi, Malika Makhlouf; Solovyev, Andrey; Ueng, Shau-Hua; Curran, Dennis P.; Malacria, Max; Fensterbank, Louis; Lacote, Emmanuel Chemistry - A European Journal, 2009 , vol. 15, # 47 p. 12937 - 12940 |
|
~%
(4-pentenyl)tri... CAS#:56771-29-0 |
| Literature: , vol. No. 9, p. 1705 - 1720 |
|
~%
(4-pentenyl)tri... CAS#:56771-29-0 |
| Literature: , vol. No. 9, p. 1705 - 1720 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-pentenyl-5-triphenylphosphonium bromide |
| MFCD00050215 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: Molecular weight of pent-4-enyl(triphenyl)phosphanium,bromide is 411.31400. |
| Q: What is the molecular formula of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: Molecular formula of pent-4-enyl(triphenyl)phosphanium,bromide is C23H24BrP. |
| Q: What is the InChIKey of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: InChIKey of pent-4-enyl(triphenyl)phosphanium,bromide is KANICXDUFCDRDS-UHFFFAOYSA-M. |
| Q: What is the LogP of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: LogP of pent-4-enyl(triphenyl)phosphanium,bromide is 1.95070. |
| Q: What is the English name of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: The English name of pent-4-enyl(triphenyl)phosphanium,bromide is pent-4-enyl(triphenyl)phosphanium,bromide. |
| Q: What English synonyms does pent-4-enyl(triphenyl)phosphanium,bromide have? |
| A: English synonyms of pent-4-enyl(triphenyl)phosphanium,bromide: 1-pentenyl-5-triphenylphosphonium bromide, MFCD00050215. |
| Q: What is the SMILES notation of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: SMILES notation of pent-4-enyl(triphenyl)phosphanium,bromide is C=CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]. |
| Q: What is the CAS number of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: CAS number of pent-4-enyl(triphenyl)phosphanium,bromide is 56771-29-0. |
| Q: What is the polar surface area (PSA) of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: Polar surface area (PSA) of pent-4-enyl(triphenyl)phosphanium,bromide is 13.59000. |
| Q: What is the melting point of pent-4-enyl(triphenyl)phosphanium,bromide? |
| A: Melting point of pent-4-enyl(triphenyl)phosphanium,bromide is 194-196ºC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |