Acid Mordant Orange 14 structure
|
Common Name | Acid Mordant Orange 14 | ||
|---|---|---|---|---|
| CAS Number | 568-93-4 | Molecular Weight | 285.20800 | |
| Density | 1.7g/cm3 | Boiling Point | 473.1ºC at 760mmHg | |
| Molecular Formula | C14H7NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.2ºC | |
| Name | 1,2-dihydroxy-3-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 473.1ºC at 760mmHg |
| Molecular Formula | C14H7NO6 |
| Molecular Weight | 285.20800 |
| Flash Point | 202.2ºC |
| Exact Mass | 285.02700 |
| PSA | 120.42000 |
| LogP | 2.30460 |
| Index of Refraction | 1.759 |
| InChIKey | XZSUEVFAMOKROK-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc([N+](=O)[O-])c(O)c2O |
|
~63%
Acid Mordant Or... CAS#:568-93-4 |
| Literature: Jain, Khushboo; Singh, Sadhana Asian Journal of Chemistry, 2011 , vol. 23, # 3 p. 1395 - 1396 |
|
~%
Acid Mordant Or... CAS#:568-93-4 |
| Literature: Barnett; Cook Journal of the Chemical Society, 1922 , vol. 121, p. 1388 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| Alizarin,3-nitro |
| Alizarine Orange A |
| 1,2-dihydroxy-3-nitro-9,10-anthracenedione |
| 3-Nitroalizarin |
| 1,2-Dihydroxy-3-nitro-anthrachinon |
| 1,2-dihydroxy-3-nitro-anthraquinone |
| Alizarin orange |
| C.I. Mordant Orange |
| 3-Nitro-1,2-dihydroxyanthrachinon |
| 3-Nitroalizarine |
| Alizarine orange |
| 3-nitro-1,2-dihydroxy-anthraquinone |