4-Methyl-2-(4-(trifluoromethyl)phenyl)thiazole-5-sulfonyl chloride structure
|
Common Name | 4-Methyl-2-(4-(trifluoromethyl)phenyl)thiazole-5-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 568577-83-3 | Molecular Weight | 341.75700 | |
| Density | 1.526g/cm3 | Boiling Point | 420.5ºC at 760 mmHg | |
| Molecular Formula | C11H7ClF3NO2S2 | Melting Point | 93ºC | |
| MSDS | USA | Flash Point | 208.1ºC | |
| Name | 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526g/cm3 |
|---|---|
| Boiling Point | 420.5ºC at 760 mmHg |
| Melting Point | 93ºC |
| Molecular Formula | C11H7ClF3NO2S2 |
| Molecular Weight | 341.75700 |
| Flash Point | 208.1ºC |
| Exact Mass | 340.95600 |
| PSA | 83.65000 |
| LogP | 5.14560 |
| Index of Refraction | 1.543 |
| InChIKey | FIPBWMJINRBLKG-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1S(=O)(=O)Cl |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3261 |
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD04974054 |