octanoic acid, compound with tributylamine (1:1) structure
|
Common Name | octanoic acid, compound with tributylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 56863-01-5 | Molecular Weight | 329.56100 | |
| Density | N/A | Boiling Point | 215.3ºC at 760 mmHg | |
| Molecular Formula | C20H43NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 63.3ºC | |
| Name | N,N-dibutylbutan-1-amine,octanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 215.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.56100 |
| Flash Point | 63.3ºC |
| Exact Mass | 329.32900 |
| PSA | 40.54000 |
| LogP | 6.12020 |
| InChIKey | FENTZGYTGCWDPS-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)O.CCCCN(CCCC)CCCC |
| HS Code | 2923900090 |
|---|
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N,N-dibutylbutan-1-amine |
| EINECS 260-409-7 |
| tributylammonium octanoate |