2-bromo-5-methylbenzenesulfonic acid structure
|
Common Name | 2-bromo-5-methylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 56919-22-3 | Molecular Weight | 251.09800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-5-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7BrO3S |
|---|---|
| Molecular Weight | 251.09800 |
| Exact Mass | 249.93000 |
| PSA | 62.75000 |
| LogP | 3.08500 |
| InChIKey | FNRMDFMXANDGKB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Br)c(S(=O)(=O)O)c1 |
|
~%
2-bromo-5-methy... CAS#:56919-22-3 |
| Literature: Cerfontain, Hans; Koeberg-Telder, Ankie; Laali, Khosrow; Lambrechts, Hans J. A.; Wit, Peter de Recueil: Journal of the Royal Netherlands Chemical Society, 1982 , vol. 101, # 11 p. 390 - 392 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-bromo-toluene-3-sulfonic acid |
| Benzenesulfonic acid,2-bromo-5-methyl |
| 4-Brom-toluol-3-sulfonsaeure |