2-Bromo-5-nitrobenzoic acid structure
|
Common Name | 2-Bromo-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 943-14-6 | Molecular Weight | 246.015 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 370.5±32.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrNO4 | Melting Point | 180-181 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 177.8±25.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-bromo-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.5±32.0 °C at 760 mmHg |
| Melting Point | 180-181 °C(lit.) |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.015 |
| Flash Point | 177.8±25.1 °C |
| Exact Mass | 244.932358 |
| PSA | 83.12000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | UVFWYVCDRKRAJH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
|
292. The rearrangement of o-hydroxysulphones. Part V. Galbraith F and Smiles S.
J. Chem. Soc. , 1234-38, (1935)
|
| 2-Bromo-5-nitrobenzoicacid |
| 2-Bromo-5-nitrobenzoic acid |
| MFCD00134558 |
| Benzoic acid, 2-bromo-5-nitro- |