2-(methyl-phenyl-amino)-1-phenyl-propan-1-one structure
|
Common Name | 2-(methyl-phenyl-amino)-1-phenyl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 56957-47-2 | Molecular Weight | 239.31200 | |
| Density | 1.086g/cm3 | Boiling Point | 374.8ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.6ºC | |
| Name | 2-(N-methylanilino)-1-phenylpropan-1-one |
|---|
| Density | 1.086g/cm3 |
|---|---|
| Boiling Point | 374.8ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 139.6ºC |
| Exact Mass | 239.13100 |
| PSA | 20.31000 |
| LogP | 3.39420 |
| Index of Refraction | 1.594 |
| InChIKey | JJRLHSCUZLITFW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)c1ccccc1)N(C)c1ccccc1 |
|
~66%
2-(methyl-pheny... CAS#:56957-47-2 |
| Literature: Mulvihill, Mark J.; Cesario, Cara; Smith, Vanessa; Beck, Patricia; Nigro, Anthony Journal of Organic Chemistry, 2004 , vol. 69, # 15 p. 5124 - 5127 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |