1-(4-bromophenoxy)-4-chloro-2-nitrobenzene structure
|
Common Name | 1-(4-bromophenoxy)-4-chloro-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 56966-65-5 | Molecular Weight | 328.54600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7BrClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenoxy)-4-chloro-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7BrClNO3 |
|---|---|
| Molecular Weight | 328.54600 |
| Exact Mass | 326.93000 |
| PSA | 55.05000 |
| LogP | 5.32620 |
| InChIKey | ZYXHTOJTZHBCRG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1Oc1ccc(Br)cc1 |
|
~%
1-(4-bromopheno... CAS#:56966-65-5 |
| Literature: Raiford; Colbert Journal of the American Chemical Society, 1926 , vol. 48, p. 2654 |
|
~%
1-(4-bromopheno... CAS#:56966-65-5 |
| Literature: McCombie; Macmillan; Scarborough Journal of the Chemical Society, 1931 , p. 529,533 |
|
~%
1-(4-bromopheno... CAS#:56966-65-5 |
| Literature: McCombie; Macmillan; Scarborough Journal of the Chemical Society, 1931 , p. 529,533 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-4'-brom-2-nitro-diphenylaether |