2-Nitro 4' Chloro Diphenyl Ether structure
|
Common Name | 2-Nitro 4' Chloro Diphenyl Ether | ||
|---|---|---|---|---|
| CAS Number | 91-39-4 | Molecular Weight | 249.65000 | |
| Density | 1.358 | Boiling Point | 334.5ºC at 760 mmHg | |
| Molecular Formula | C12H8ClNO3 | Melting Point | 36-37ºC | |
| MSDS | N/A | Flash Point | 156.1ºC | |
| Name | 2-Nitro-4-chlorodiphenylether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358 |
|---|---|
| Boiling Point | 334.5ºC at 760 mmHg |
| Melting Point | 36-37ºC |
| Molecular Formula | C12H8ClNO3 |
| Molecular Weight | 249.65000 |
| Flash Point | 156.1ºC |
| Exact Mass | 249.01900 |
| PSA | 55.05000 |
| LogP | 4.56370 |
| Index of Refraction | 1.614 |
| InChIKey | OJESLZHZRVDKCA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1Oc1ccccc1 |
| HS Code | 2909309090 |
|---|
|
~72%
2-Nitro 4' Chlo... CAS#:91-39-4 |
| Literature: ABBOTT LABORATORIES Patent: WO2008/133753 A2, 2008 ; Location in patent: Page/Page column 81-82 ; |
|
~94%
2-Nitro 4' Chlo... CAS#:91-39-4 |
| Literature: G. D. Searle and Co. Patent: US5324722 A1, 1994 ; US 5324722 A |
|
~%
2-Nitro 4' Chlo... CAS#:91-39-4 |
| Literature: Advanced Synthesis and Catalysis, , vol. 349, # 14-15 p. 2286 - 2300 |
|
~%
2-Nitro 4' Chlo... CAS#:91-39-4 |
| Literature: Journal of the American Chemical Society, , vol. 48, p. 2654 |
|
~%
2-Nitro 4' Chlo... CAS#:91-39-4 |
| Literature: Journal of the Chemical Society, , p. 529,533 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (4-Chlor-2-nitro-phenyl)-phenyl-aether |
| 4-chloro-2-nitro-1-phenoxy-benzene |
| (4-Chlor-2-nitro-phenyl)-phenyl-ether |
| (4-chloro-2-nitro-phenyl)-phenyl ether |
| 2-Nitro 4' Chloro Diphenyl Ether |
| 4-chloro-2-nitrodiphenyl ether |
| 4-Chlor-2-nitro-diphenylaether |