2,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrrole structure
|
Common Name | 2,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrrole | ||
|---|---|---|---|---|
| CAS Number | 570-05-8 | Molecular Weight | 239.23600 | |
| Density | 1.15g/cm3 | Boiling Point | 282.1ºC at 760 mmHg | |
| Molecular Formula | C13H12F3N | Melting Point | 70-72ºC | |
| MSDS | N/A | Flash Point | 124.4ºC | |
| Name | 2,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 282.1ºC at 760 mmHg |
| Melting Point | 70-72ºC |
| Molecular Formula | C13H12F3N |
| Molecular Weight | 239.23600 |
| Flash Point | 124.4ºC |
| Exact Mass | 239.09200 |
| PSA | 4.93000 |
| LogP | 4.11290 |
| Index of Refraction | 1.499 |
| InChIKey | UWHVRMCDWMXTOE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)n1-c1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933990090 |
|
~88%
2,5-dimethyl-1-... CAS#:570-05-8 |
| Literature: Murugesan, Dinakaran; Mital, Alka; Kaiser, Marcel; Shackleford, David M.; Morizzi, Julia; Katneni, Kasiram; Campbell, Michael; Hudson, Alan; Charman, Susan A.; Yeates, Clive; Gilbert, Ian H. Journal of Medicinal Chemistry, 2013 , vol. 56, # 7 p. 2975 - 2990 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-dimethyl-1-(4-trifluoromethyl-phenyl)-pyrrole |
| 2,5-Dimethyl-1-(4-trifluromethyl-phenyl)-pyrrol |
| 2,4-DIMETHYL-3-HYDROXYPYRIDINE |
| 2,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrrole |