3,4,5-tris(ethoxycarbonyloxy)benzoic acid structure
|
Common Name | 3,4,5-tris(ethoxycarbonyloxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5701-13-3 | Molecular Weight | 386.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4,5-tris(ethoxycarbonyloxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18O11 |
|---|---|
| Molecular Weight | 386.30800 |
| Exact Mass | 386.08500 |
| PSA | 143.89000 |
| LogP | 2.99070 |
| InChIKey | QNGKNXQWCLCEOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Oc1cc(C(=O)O)cc(OC(=O)OCC)c1OC(=O)OCC |
| HS Code | 2918990090 |
|---|
|
~76%
3,4,5-tris(etho... CAS#:5701-13-3 |
| Literature: Hanselaer, R.; D'Haenens, L.; Martens, M.; Nieuwenhuyse, H. van; Sumere, C. F. van Bulletin des Societes Chimiques Belges, 1983 , vol. 92, # 11-12 p. 1029 - 1038 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Gallussaeure-O3.O4.O5-tris-carbonsaeureaethylester |
| O,O,O-triethoxycarbonylgallic acid |
| 3,4,5-Tris-aethoxycarbonyloxy-benzoesaeure |
| Tricarbaethoxy-gallussaeure |
| 3,4,5-tris-ethoxycarbonyloxy-benzoic acid |