tambulin
tambulin structure
|
Common Name | tambulin | ||
|---|---|---|---|---|
| CAS Number | 571-72-2 | Molecular Weight | 344.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: tambulin (CAS number: 571-72-2), molecular formula C18H16O7, molecular weight 344.31500, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tambulin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H16O7 |
|---|---|
| Molecular Weight | 344.31500 |
| Exact Mass | 344.09000 |
| PSA | 98.36000 |
| LogP | 2.89700 |
| InChIKey | KAPZSMYEZDLAFB-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3c(OC)c(OC)cc(O)c3c(=O)c2O)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:527-95-7This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Herbacetin 7,8,4'-trimethyl ether |
| 3,5-dihydroxy-7,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| Tambulin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 571-72-2? |
| A: Chinese name of 571-72-2 is 571-72-2. |
| Q: What is the molecular weight of tambulin? |
| A: Molecular weight of tambulin is 344.31500. |
| Q: What is the CAS number of tambulin? |
| A: CAS number of tambulin is 571-72-2. |
| Q: What is the English name of tambulin? |
| A: The English name of tambulin is tambulin. |
| Q: What is the LogP of tambulin? |
| A: LogP of tambulin is 2.89700. |
| Q: What is the polar surface area (PSA) of tambulin? |
| A: Polar surface area (PSA) of tambulin is 98.36000. |
| Q: What is the molecular formula of tambulin? |
| A: Molecular formula of tambulin is C18H16O7. |
| Q: What are the downstream products of tambulin? |
| A: Related downstream products(CAS) of tambulin: 527-95-7. |
| Q: What is the SMILES notation of tambulin? |
| A: SMILES notation of tambulin is COc1ccc(-c2oc3c(OC)c(OC)cc(O)c3c(=O)c2O)cc1. |
| Q: What English synonyms does tambulin have? |
| A: English synonyms of tambulin: Herbacetin 7,8,4'-trimethyl ether, 3,5-dihydroxy-7,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one, Tambulin. |