Herbacetin structure
|
Common Name | Herbacetin | ||
|---|---|---|---|---|
| CAS Number | 527-95-7 | Molecular Weight | 302.236 | |
| Density | 1.799 | Boiling Point | 618.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H10O7 | Melting Point | 284ºC | |
| MSDS | Chinese USA | Flash Point | 239.0±25.0 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of HerbacetinHerbacetin is a natural flavonoid from flaxseed, exerts various pharmacological activities, including antioxidant, anti-inflammatory and anticancer effects[1]. Herbacetin is an Ornithine decarboxylase (ODC) allosteric inhibitor, directly binds to Asp44, Asp243, and Glu384 on ODC. Ornithine decarboxylase (ODC) is a rate-limiting enzyme in the first step of polyamine biosynthesis[2]. |
| Name | 3,5,7,8-tetrahydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Herbacetin is a natural flavonoid from flaxseed, exerts various pharmacological activities, including antioxidant, anti-inflammatory and anticancer effects[1]. Herbacetin is an Ornithine decarboxylase (ODC) allosteric inhibitor, directly binds to Asp44, Asp243, and Glu384 on ODC. Ornithine decarboxylase (ODC) is a rate-limiting enzyme in the first step of polyamine biosynthesis[2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: Ornithine decarboxylase[2] |
| In Vivo | Herbacetin (orally administration; 20mg/kg) significantly reduces the body weight, plasma glucose, plasma insulin, and HOMA-IR activity in obesity associated insulin resistant mice (OIR). (Herbacetin dissolves in 0.5% DMSO)[1]. Herbacetin (intraperitoneal injection; 0.4, 2, 10 or 20 mg/kg; B.W.) decreases the number and size of polyps in APCMin+ mice with no overt toxicity[2]. |
| References |
| Density | 1.799 |
|---|---|
| Boiling Point | 618.7±55.0 °C at 760 mmHg |
| Melting Point | 284ºC |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.236 |
| Flash Point | 239.0±25.0 °C |
| Exact Mass | 302.042664 |
| PSA | 131.36000 |
| LogP | 1.14 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.823 |
| InChIKey | ZDOTZEDNGNPOEW-UHFFFAOYSA-N |
| SMILES | O=c1c(O)c(-c2ccc(O)cc2)oc2c(O)c(O)cc(O)c12 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2914501900 |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3,5,7,8-Tetrahydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| 8-Hydroxykaempferol |
| 4H-1-Benzopyran-4-one, 3,5,7,8-tetrahydroxy-2-(4-hydroxyphenyl)- |
| Herbacetin |
| 3,4',5,7,8-Pentahydroxyflavone |
| 3,4´,5,7,8-pentahydroxyflavone |
| 3,5,7,8,4'-pentahydroxyflavone |