4,4'-Propane-2,2-diylbis(2-cyclohexylphenol) structure
|
Common Name | 4,4'-Propane-2,2-diylbis(2-cyclohexylphenol) | ||
|---|---|---|---|---|
| CAS Number | 57100-74-0 | Molecular Weight | 392.573 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 469.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C27H36O2 | Melting Point | 170ºC | |
| MSDS | N/A | Flash Point | 195.6±21.9 °C | |
| Name | 2,2-Bis(3-cyclohexyl-4-hydroxyphenyl)propane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.9±40.0 °C at 760 mmHg |
| Melting Point | 170ºC |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.573 |
| Flash Point | 195.6±21.9 °C |
| Exact Mass | 392.271515 |
| PSA | 40.46000 |
| LogP | 8.47 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | WKVWOPDUENJKAR-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)c(C2CCCCC2)c1)c1ccc(O)c(C2CCCCC2)c1 |
| HS Code | 2907299090 |
|---|
|
~%
4,4'-Propane-2,... CAS#:57100-74-0 |
| Literature: Angewandte Chemie, , vol. 68, p. 633,634 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,4'-(2,2-Propanediyl)bis(2-cyclohexylphenol) |
| Phenol, 4,4'-(1-methylethylidene)bis[2-cyclohexyl- |
| 4,4'-Propane-2,2-diylbis(2-cyclohexylphenol) |
| 2-cyclohexyl-4-[2-(3-cyclohexyl-4-hydroxyphenyl)propan-2-yl]phenol |