Diallyl bisphenol A structure
|
Common Name | Diallyl bisphenol A | ||
|---|---|---|---|---|
| CAS Number | 1745-89-7 | Molecular Weight | 308.414 | |
| Density | 1.08 | Boiling Point | 445.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C21H24O2 | Melting Point | -52ºC | |
| MSDS | Chinese USA | Flash Point | >110 ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Diallyl Bisphenol A |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08 |
|---|---|
| Boiling Point | 445.2±40.0 °C at 760 mmHg |
| Melting Point | -52ºC |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.414 |
| Flash Point | >110 ºC |
| Exact Mass | 308.177643 |
| PSA | 40.46000 |
| LogP | 5.47 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | WOCGGVRGNIEDSZ-UHFFFAOYSA-N |
| SMILES | C=CCc1cc(C(C)(C)c2ccc(O)c(CC=C)c2)ccc1O |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H317 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34;R43 |
| Safety Phrases | 23-26-27-36/37/39-45 |
| RIDADR | UN 1760 8/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2907299090 |
|
~92%
Diallyl bisphenol A CAS#:1745-89-7 |
| Literature: Journal of Organic Chemistry, , vol. 62, # 6 p. 1899 - 1902 |
|
~%
Diallyl bisphenol A CAS#:1745-89-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 16 p. 4428 - 4431 |
|
~0%
Diallyl bisphenol A CAS#:1745-89-7
Detail
|
| Literature: Applied Organometallic Chemistry, , vol. 25, # 3 p. 207 - 211 |
|
~0%
Diallyl bisphenol A CAS#:1745-89-7
Detail
|
| Literature: Applied Organometallic Chemistry, , vol. 25, # 3 p. 207 - 211 |
|
~0%
Diallyl bisphenol A CAS#:1745-89-7
Detail
|
| Literature: Applied Organometallic Chemistry, , vol. 25, # 3 p. 207 - 211 |
|
~%
Diallyl bisphenol A CAS#:1745-89-7 |
| Literature: European Journal of Medicinal Chemistry, , vol. 18, # 1 p. 61 - 66 |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,2'-Diallylbisphenol A |
| EINECS 217-121-1 |
| 4-[2-(4-hydroxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenol |
| Allyl bisphenol A |
| MFCD00191977 |
| 4,4'-Propane-2,2-diylbis(2-allylphenol) |
| 2,2-Bis(4-hydroxy-3-allylphenyl)propane |
| 4,4'-(2,2-Propanediyl)bis(2-allylphenol) |
| 4,4'-propane-2,2-diylbis[2-(prop-2-en-1-yl)phenol] |
| Phenol, 4,4'-(1-methylethylidene)bis[2-(2-propen-1-yl)- |
| Phenol, 4,4'-(1-methylethylidene)bis(2-(2-propenyl)- |
| 4,4'-ISOPROPYLIDENEBIS(2-ALLYLPHENOL) |