Indoleacetyl phenylalanine structure
|
Common Name | Indoleacetyl phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 57105-50-7 | Molecular Weight | 322.35800 | |
| Density | 1.311 g/cm3 | Boiling Point | 658.9ºC at 760 mmHg | |
| Molecular Formula | C19H18N2O3 | Melting Point | 154-156 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 352.3ºC | |
Use of Indoleacetyl phenylalanine(S)-2-(2-(1H-Indol-3-yl)acetamido)-3-phenylpropanoic acid is a phenylalanine derivative[1]. |
| Name | N-(3-Indolylacetyl)-L-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-2-(2-(1H-Indol-3-yl)acetamido)-3-phenylpropanoic acid is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.311 g/cm3 |
|---|---|
| Boiling Point | 658.9ºC at 760 mmHg |
| Melting Point | 154-156 °C(lit.) |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.35800 |
| Flash Point | 352.3ºC |
| Exact Mass | 322.13200 |
| PSA | 82.19000 |
| LogP | 2.91340 |
| Index of Refraction | 1.667 |
| InChIKey | BUGQHORRADGONS-KRWDZBQOSA-N |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NC(Cc1ccccc1)C(=O)O |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-3-INDOLYACETYL-L-PHENYLALANINE |
| INDOLE-3-ACETYL-L-PHENYLALANINE |
| N-3-INDOLEACETAL-L-PHENYLALANINE |
| Indolylacetyl Phenylalanine |
| IAA-L-PHE |
| MFCD00075336 |