Benzenesulfonamide,N,N'-1,5-naphthalenediylbis[4-methyl structure
|
Common Name | Benzenesulfonamide,N,N'-1,5-naphthalenediylbis[4-methyl | ||
|---|---|---|---|---|
| CAS Number | 57159-76-9 | Molecular Weight | 466.57200 | |
| Density | 1.395g/cm3 | Boiling Point | 671.1ºC at 760mmHg | |
| Molecular Formula | C24H22N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 359.6ºC | |
| Name | N,N'-(naphthalene-1,5-diyl)bis(4-methylbenzenesulfonamide) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.395g/cm3 |
|---|---|
| Boiling Point | 671.1ºC at 760mmHg |
| Molecular Formula | C24H22N2O4S2 |
| Molecular Weight | 466.57200 |
| Flash Point | 359.6ºC |
| Exact Mass | 466.10200 |
| PSA | 109.10000 |
| LogP | 7.36580 |
| Index of Refraction | 1.69 |
| InChIKey | MIVPUXMNDCDKFL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc3c(NS(=O)(=O)c4ccc(C)cc4)cccc23)cc1 |
|
~%
Benzenesulfonam... CAS#:57159-76-9 |
| Literature: Hodgson; Whitehurst Journal of the Chemical Society, 1945 , p. 202 |
|
~%
Benzenesulfonam... CAS#:57159-76-9 |
| Literature: Hodgson; Whitehurst Journal of the Chemical Society, 1945 , p. 202 |
|
~%
Benzenesulfonam... CAS#:57159-76-9 |
| Literature: Hodgson; Whitehurst Journal of the Chemical Society, 1945 , p. 202 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| N,N'-m-xylylene-bis-toluene-4-sulfonamide |
| 1.5-Bis-tosylamino-naphthalin |
| N,N'-Naphthalin-1,5-diyl-bis-toluol-4-sulfonamid |
| N,N'-Naphthalin-1,5-diyl-bis-acetamid |
| 1.5-Bis-acetamino-naphthalin |
| N,N'-m-Xylylen-bis-toluol-4-sulfonamid |
| N,N'-naphthalene-1,5-diyl-bis-acetamide |
| N,N'-naphthalene-1,5-diyl-bis-toluene-4-sulfonamide |