2,5-bis(4-methylphenyl)furan
2,5-bis(4-methylphenyl)furan structure
|
Common Name | 2,5-bis(4-methylphenyl)furan | ||
|---|---|---|---|---|
| CAS Number | 57196-75-5 | Molecular Weight | 248.31900 | |
| Density | 1.055g/cm3 | Boiling Point | 369.4ºC at 760 mmHg | |
| Molecular Formula | C18H16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.5ºC | |
Summary: 2,5-bis(4-methylphenyl)furan (Chinese name: 2,5-二(4-甲基苯基)呋喃, CAS number: 57196-75-5, molecular formula: C18H16O, molecular weight: 248.31900) is an organic compound with a boiling point of 369.4°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-bis(4-methylphenyl)furan |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.055g/cm3 |
|---|---|
| Boiling Point | 369.4ºC at 760 mmHg |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.31900 |
| Flash Point | 178.5ºC |
| Exact Mass | 248.12000 |
| PSA | 13.14000 |
| LogP | 5.23040 |
| Index of Refraction | 1.571 |
| InChIKey | ACGDQFJBTKFRNT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccc(-c3ccc(C)cc3)o2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
![1-methyl-4-[4-(4-methylphenyl)buta-1,3-diynyl]benzene Structure](https://image.chemsrc.com/caspic/374/22666-07-5.png)
CAS#:22666-07-5
CAS#:66864-60-6
CAS#:5465-41-8
CAS#:1145987-14-9
CAS#:32460-00-7
CAS#:5142-75-6
CAS#:13145-56-7
CAS#:15982-67-9This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,5-bis(4-methylphenyl)furan? |
| A: Molecular formula of 2,5-bis(4-methylphenyl)furan is C18H16O. |
| Q: What is the English name of 2,5-bis(4-methylphenyl)furan? |
| A: The English name of 2,5-bis(4-methylphenyl)furan is 2,5-bis(4-methylphenyl)furan. |
| Q: What is the CAS number of 2,5-bis(4-methylphenyl)furan? |
| A: CAS number of 2,5-bis(4-methylphenyl)furan is 57196-75-5. |
| Q: What is the InChIKey of 2,5-bis(4-methylphenyl)furan? |
| A: InChIKey of 2,5-bis(4-methylphenyl)furan is ACGDQFJBTKFRNT-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2,5-bis(4-methylphenyl)furan? |
| A: Boiling point of 2,5-bis(4-methylphenyl)furan is 369.4ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 2,5-bis(4-methylphenyl)furan? |
| A: Polar surface area (PSA) of 2,5-bis(4-methylphenyl)furan is 13.14000. |
| Q: What is the LogP of 2,5-bis(4-methylphenyl)furan? |
| A: LogP of 2,5-bis(4-methylphenyl)furan is 5.23040. |
| Q: What is the SMILES notation of 2,5-bis(4-methylphenyl)furan? |
| A: SMILES notation of 2,5-bis(4-methylphenyl)furan is Cc1ccc(-c2ccc(-c3ccc(C)cc3)o2)cc1. |
| Q: What is the Chinese name of 57196-75-5? |
| A: Chinese name of 57196-75-5 is 57196-75-5. |
| Q: What is the molecular weight of 2,5-bis(4-methylphenyl)furan? |
| A: Molecular weight of 2,5-bis(4-methylphenyl)furan is 248.31900. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |