ethyl 5-chloro-2-(ethoxycarbonylmethoxy)benzoate structure
|
Common Name | ethyl 5-chloro-2-(ethoxycarbonylmethoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 57202-99-0 | Molecular Weight | 286.70800 | |
| Density | 1.231g/cm3 | Boiling Point | 379.3ºC at 760 mmHg | |
| Molecular Formula | C13H15ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.4ºC | |
| Name | ethyl 5-chloro-2-(2-ethoxy-2-oxoethoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 379.3ºC at 760 mmHg |
| Molecular Formula | C13H15ClO5 |
| Molecular Weight | 286.70800 |
| Flash Point | 147.4ºC |
| Exact Mass | 286.06100 |
| PSA | 61.83000 |
| LogP | 2.45860 |
| Index of Refraction | 1.512 |
| InChIKey | HVAXDJCWOIRPQZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1ccc(Cl)cc1C(=O)OCC |
| HS Code | 2918990090 |
|---|
|
~%
ethyl 5-chloro-... CAS#:57202-99-0 |
| Literature: Schroeder,D.C. et al. Journal of Organic Chemistry, 1962 , vol. 27, p. 586 - 591 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Chlor-2-aethoxycarbonylmethoxy-benzoesaeure-aethylester |