tert-butyl 4-benzylpiperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-benzylpiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 57260-70-5 | Molecular Weight | 276.374 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 362.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H24N2O2 | Melting Point | 71-73 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 173.1±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Benzyl-4-Boc-Piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 362.5±35.0 °C at 760 mmHg |
| Melting Point | 71-73 °C(lit.) |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.374 |
| Flash Point | 173.1±25.9 °C |
| Exact Mass | 276.183777 |
| PSA | 32.78000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | GVHSMUYEAWMYLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)CC1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-benzylpiperazine-1-carboxylate |
| 1-Piperazinecarboxylic acid, 4-(phenylmethyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 4-benzyl-1-piperazinecarboxylate |
| MFCD00075603 |