3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide structure
|
Common Name | 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide | ||
|---|---|---|---|---|
| CAS Number | 5727-80-0 | Molecular Weight | 270.77800 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.77800 |
| Exact Mass | 270.05900 |
| PSA | 70.25000 |
| LogP | 4.17450 |
| Index of Refraction | 1.571 |
| InChIKey | GGQFQHAOZLBEPW-UHFFFAOYSA-N |
| SMILES | CC(C)=NNC(=O)CCSc1ccc(Cl)cc1 |
|
~85%
3-(4-chlorophen... CAS#:5727-80-0 |
| Literature: Odinets; Vinogradova; Artyushin; Kalyanova; Lyssenko; Petrovskii; Mastryukova; Kabachnik Russian Chemical Bulletin, 1998 , vol. 47, # 5 p. 960 - 966 |
|
~%
3-(4-chlorophen... CAS#:5727-80-0 |
| Literature: Vinogradova, Natalya M.; Odinets, Irene L.; Artyushin, Oleg I.; Lyssenko, Konstantin A.; Petrovsky, Pavel V.; Mastryukova, Tatyana A. Phosphorus, Sulfur and Silicon and Related Elements, 1999 , vol. 144-146, p. 589 - 592 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| <2-Cyan-isopropyl>-diphenyl-phosphinsulfid |