3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide
3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide structure
|
Common Name | 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide | ||
|---|---|---|---|---|
| CAS Number | 5727-80-0 | Molecular Weight | 270.77800 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.77800 |
| Exact Mass | 270.05900 |
| PSA | 70.25000 |
| LogP | 4.17450 |
| Index of Refraction | 1.571 |
| InChIKey | GGQFQHAOZLBEPW-UHFFFAOYSA-N |
| SMILES | CC(C)=NNC(=O)CCSc1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
3-(4-chlorophen... CAS#:5727-80-0 |
| Literature: Odinets; Vinogradova; Artyushin; Kalyanova; Lyssenko; Petrovskii; Mastryukova; Kabachnik Russian Chemical Bulletin, 1998 , vol. 47, # 5 p. 960 - 966 |
|
~%
3-(4-chlorophen... CAS#:5727-80-0 |
| Literature: Vinogradova, Natalya M.; Odinets, Irene L.; Artyushin, Oleg I.; Lyssenko, Konstantin A.; Petrovsky, Pavel V.; Mastryukova, Tatyana A. Phosphorus, Sulfur and Silicon and Related Elements, 1999 , vol. 144-146, p. 589 - 592 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| <2-Cyan-isopropyl>-diphenyl-phosphinsulfid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide? |
| A: SMILES notation of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide is CC(C)=NNC(=O)CCSc1ccc(Cl)cc1. |
| Q: What is the Chinese name of 5727-80-0? |
| A: Chinese name of 5727-80-0 is 5727-80-0. |
| Q: What is the molecular weight of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide? |
| A: Molecular weight of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide is 270.77800. |
| Q: What is the polar surface area (PSA) of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide? |
| A: Polar surface area (PSA) of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide is 70.25000. |
| Q: What English synonyms does 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide have? |
| A: English synonyms of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide: -diphenyl-phosphinsulfid. |
| Q: What is the InChIKey of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide? |
| A: InChIKey of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide is GGQFQHAOZLBEPW-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide? |
| A: CAS number of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide is 5727-80-0. |
| Q: What is the molecular formula of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide? |
| A: Molecular formula of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide is C12H15ClN2OS. |
| Q: What is the English name of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide? |
| A: The English name of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide is 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide. |
| Q: What are the upstream materials of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide? |
| A: Related upstream materials(CAS) of 3-(4-chlorophenyl)sulfanyl-N-(propan-2-ylideneamino)propanamide: 69039-10-7;74-88-4. |