2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[(4-hydroxyphenyl)methylene]-1,3-dimethyl- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[(4-hydroxyphenyl)methylene]-1,3-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 57270-80-1 | Molecular Weight | 260.24500 | |
| Density | 1.412g/cm3 | Boiling Point | 418.8ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.1ºC | |
| Name | 5-[(4-hydroxyphenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 418.8ºC at 760 mmHg |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.24500 |
| Flash Point | 207.1ºC |
| Exact Mass | 260.08000 |
| PSA | 77.92000 |
| LogP | 0.70180 |
| Index of Refraction | 1.658 |
| InChIKey | VLSZBBLFPBINKZ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=Cc2ccc(O)cc2)C(=O)N(C)C1=O |
|
~99%
2,4,6(1H,3H,5H)... CAS#:57270-80-1 |
| Literature: Kaupp, Gerd; Naimi-Jamal, M. Reza; Schmeyers, Jens Tetrahedron, 2003 , vol. 59, # 21 p. 3753 - 3760 |
|
~65%
2,4,6(1H,3H,5H)... CAS#:57270-80-1 |
| Literature: Shi, Daqing; Shi, Jingwen; Rong, Shaofeng Chinese Journal of Chemistry, 2010 , vol. 28, # 5 p. 791 - 796 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| hms1653j02 |