BOC-D-4-Fluorophe structure
|
Common Name | BOC-D-4-Fluorophe | ||
|---|---|---|---|---|
| CAS Number | 57292-45-2 | Molecular Weight | 283.295 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 431.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H18FNO4 | Melting Point | 83-86 °C | |
| MSDS | USA | Flash Point | 214.6±27.3 °C | |
Use of BOC-D-4-Fluorophe(R)-2-((tert-Butoxycarbonyl)amino)-3-(4-fluorophenyl)propanoic acid is a phenylalanine derivative[1]. |
| Name | BOC-D-4-Fluorophe |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-2-((tert-Butoxycarbonyl)amino)-3-(4-fluorophenyl)propanoic acid is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.2±40.0 °C at 760 mmHg |
| Melting Point | 83-86 °C |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.295 |
| Flash Point | 214.6±27.3 °C |
| Exact Mass | 283.121979 |
| PSA | 75.63000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | RCXSXRAUMLKRRL-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(F)cc1)C(=O)O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Name: Compound was evaluated for the inhibition of Trypanosoma cruzi LAP (at 30 µM)
Source: ChEMBL
Target: Aminopeptidase
External Id: CHEMBL5305022
|
| (2R)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| boc-(s)-3-amino-3-(4-fluoro-phenyl)-propionic acid |
| (2R)-3-(4-Fluorophenyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| Boc-L-phe(4-F)-OH |
| N-(tert-Butoxycarbonyl)-4-fluoro-D-phenylalanine |
| MFCD00079669 |
| N-(tert-Butoxycarbonyl)-4-fluoro-L-phenylalanine |
| 4-Fluoro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine |
| (2S)-3-(4-Fluorophenyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 4-Fluoro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |
| Boc-D-Phe(4-F)-OH |