n4-aminocytidine structure
|
Common Name | n4-aminocytidine | ||
|---|---|---|---|---|
| CAS Number | 57294-74-3 | Molecular Weight | 260.24700 | |
| Density | 1.93g/cm3 | Boiling Point | 555.5ºC at 760mmHg | |
| Molecular Formula | C9H16N4O5 | Melting Point | >160 °C(sublime) | |
| MSDS | Chinese USA | Flash Point | 289.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | n4-aminocytidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.93g/cm3 |
|---|---|
| Boiling Point | 555.5ºC at 760mmHg |
| Melting Point | >160 °C(sublime) |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.24700 |
| Flash Point | 289.8ºC |
| Exact Mass | 260.11200 |
| PSA | 140.31000 |
| Index of Refraction | 1.776 |
| InChIKey | RSSRMDMJEZIUJX-XVFCMESISA-N |
| SMILES | NNc1ccn(C2OC(CO)C(O)C2O)c(=O)n1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 46-20/21/22 |
| Safety Phrases | 53-22-36/37/39-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | YU8055000 |
| HS Code | 29335990 |
|
Genotoxic properties of representatives of alkylindazoles and aminoalkyl-indoles which are consumed as synthetic cannabinoids.
Food Chem. Toxicol. 80 , 130-6, (2015) Synthetic cannabinoids (SCs) cause similar effects as cannabis and are sold in herbal mixtures. Recent investigations indicate that some of these drugs possess genotoxic properties. Therefore, we test... |
|
|
Mutagenic nucleoside analog N4-aminocytidine: metabolism, incorporation into DNA, and mutagenesis in Escherichia coli.
J. Bacteriol. 170(11) , 5257-62, (1988) N4-Aminocytidine, a nucleoside analog, is strongly mutagenic to various organisms including Escherichia coli. Using E. coli WP2 (trp), we measured the incorporation of [5-3H]N4-aminocytidine into DNA ... |
|
|
An improved synthesis of N4-aminocytidine.
Chem. Pharm. Bull. 35(9) , 3884-7, (1987)
|
| N-Aminocytidine |
| N4-aminocytidine minimum |
| N4-NH2-Cr |
| n(sup4)-aminocytidine |
| uridine,4-hydrazone |