Benzilam structure
|
Common Name | Benzilam | ||
|---|---|---|---|---|
| CAS Number | 573-34-2 | Molecular Weight | 297.35000 | |
| Density | 1.137g/cm3 | Boiling Point | 449.4ºC at 760 mmHg | |
| Molecular Formula | C21H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | 2,4,5-triphenyl-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 449.4ºC at 760 mmHg |
| Molecular Formula | C21H15NO |
| Molecular Weight | 297.35000 |
| Flash Point | 191.8ºC |
| Exact Mass | 297.11500 |
| PSA | 26.03000 |
| LogP | 5.67560 |
| Index of Refraction | 1.608 |
| InChIKey | WKHQADGJXFRQJD-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)o2)cc1 |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
|
Name: ASTRAZENECA: Solubility in pH7.4 buffer using solid starting material using the metho...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3301364
|
| triphenyl-oxazole |
| Oxazole,triphenyl |
| 2,4,5-triphenyl-oxazole |
| Benzilam |
| Triphenyl-oxazol |
| 2,5-Triphenyloxazole |