N-[(3-nitrophenyl)methyl]adamantan-1-amine
Modify Date: 2025-09-24 16:49:52
![N-[(3-nitrophenyl)methyl]adamantan-1-amine Structure](https://image.chemsrc.com/caspic/358/57304-72-0.png)
N-[(3-nitrophenyl)methyl]adamantan-1-amine structure
|
Common Name | N-[(3-nitrophenyl)methyl]adamantan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 57304-72-0 | Molecular Weight | 286.36900 | |
| Density | 1.21g/cm3 | Boiling Point | 430ºC at 760 mmHg | |
| Molecular Formula | C17H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | N-[(3-nitrophenyl)methyl]adamantan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 430ºC at 760 mmHg |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.36900 |
| Flash Point | 213.9ºC |
| Exact Mass | 286.16800 |
| PSA | 57.85000 |
| LogP | 4.56730 |
| Index of Refraction | 1.605 |
| InChIKey | BOCVGZIFAMULNU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CNC23CC4CC(CC(C4)C2)C3)c1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ccg-9829 |