4-(4-bromophenyl)benzoic acid structure
|
Common Name | 4-(4-bromophenyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5731-11-3 | Molecular Weight | 277.11300 | |
| Density | 1.51g/cm3 | Boiling Point | 418.1ºC at 760 mmHg | |
| Molecular Formula | C13H9BrO2 | Melting Point | 301-302ºC | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | 4'-Bromo[1,1'-biphenyl]-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 418.1ºC at 760 mmHg |
| Melting Point | 301-302ºC |
| Molecular Formula | C13H9BrO2 |
| Molecular Weight | 277.11300 |
| Flash Point | 206.7ºC |
| Exact Mass | 275.97900 |
| PSA | 37.30000 |
| LogP | 3.81430 |
| Index of Refraction | 1.632 |
| InChIKey | UTHDVFIFIMWTJQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(Br)cc2)cc1 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(4-bromophenyl)benzoic acid |