WAY-348375 structure
|
Common Name | WAY-348375 | ||
|---|---|---|---|---|
| CAS Number | 573705-08-5 | Molecular Weight | 367.42 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 648.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C19H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.1±34.3 °C | |
Use of WAY-348375ACE2 inhibitor |
| Name | WAY-348375 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 648.7±65.0 °C at 760 mmHg |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.42 |
| Flash Point | 346.1±34.3 °C |
| Exact Mass | 367.099060 |
| LogP | 4.63 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | UYXCSEHUAJNVQT-GZTJUZNOSA-N |
| SMILES | Cc1nc(SC(=Cc2ccc(OCc3ccccc3)cc2)C(=O)O)n[nH]1 |
| (2E)-3-[4-(Benzyloxy)phenyl]-2-[(3-methyl-1H-1,2,4-triazol-4-ium-5-yl)sulfanyl]acrylate |
| 2-Propenoic acid, 2-[(5-methyl-1H-1,2,4-triazol-3-yl)thio]-3-[4-(phenylmethoxy)phenyl]-, (2E)- |
| (2E)-3-[4-(Benzyloxy)phenyl]-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acrylic acid |
| 1H-1,2,4-triazolium, 5-[[(E)-1-carboxy-2-[4-(phenylmethoxy)phenyl]ethenyl]thio]-3-methyl-, inner salt |