N-(4-acetylphenyl)-2,6-dichlorobenzamide structure
|
Common Name | N-(4-acetylphenyl)-2,6-dichlorobenzamide | ||
|---|---|---|---|---|
| CAS Number | 5739-33-3 | Molecular Weight | 308.15900 | |
| Density | 1.377g/cm3 | Boiling Point | 397.8ºC at 760 mmHg | |
| Molecular Formula | C15H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4ºC | |
| Name | N-(4-acetylphenyl)-2,6-dichlorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 397.8ºC at 760 mmHg |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.15900 |
| Flash Point | 194.4ºC |
| Exact Mass | 307.01700 |
| PSA | 46.17000 |
| LogP | 4.52130 |
| Index of Refraction | 1.64 |
| InChIKey | WSWRXGRWRLUPBD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1 |
|
~%
N-(4-acetylphen... CAS#:5739-33-3 |
| Literature: Kornfeld Journal of Organic Chemistry, 1951 , vol. 16, p. 131,133 |
|
~%
N-(4-acetylphen... CAS#:5739-33-3 |
| Literature: Schmitt; Suquet Bulletin de la Societe Chimique de France, 1956 , p. 755,756 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 3-<4-Methoxy-phenyl>-thiopropionsaeure-morpholid |
| ss-<p-Methoxy-phenyl>-thiopropionmorpholid |