1-(4-methoxyphenyl)-3-phenyl-propan-1-one structure
|
Common Name | 1-(4-methoxyphenyl)-3-phenyl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5739-38-8 | Molecular Weight | 240.29700 | |
| Density | 1.081g/cm3 | Boiling Point | 392.4ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | 1-(4-methoxyphenyl)-3-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 392.4ºC at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 175.3ºC |
| Exact Mass | 240.11500 |
| PSA | 26.30000 |
| LogP | 3.51070 |
| Index of Refraction | 1.562 |
| InChIKey | WMPHLIJZKDSFFR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCc2ccccc2)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4'-methoxy-3-phenylpropiophenone |