Aureothricin structure
|
Common Name | Aureothricin | ||
|---|---|---|---|---|
| CAS Number | 574-95-8 | Molecular Weight | 242.31800 | |
| Density | 1.48g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.6ºC | |
Use of AureothricinAureothricin is a dithiolopyrrolone (DTP) antibiotic first isolated from Streptomyces and exhibits relatively broad-spectrum antibiotic activity. Aureothricin can inhibit adhesion of human umbilical vein endothelial cells (HUVECs) to vitronectin[1]. |
| Name | N-(4-methyl-5-oxodithiolo[4,3-b]pyrrol-6-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Aureothricin is a dithiolopyrrolone (DTP) antibiotic first isolated from Streptomyces and exhibits relatively broad-spectrum antibiotic activity. Aureothricin can inhibit adhesion of human umbilical vein endothelial cells (HUVECs) to vitronectin[1]. |
|---|---|
| Related Catalog | |
| Target |
Bacteral[1] |
| References |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Molecular Formula | C9H10N2O2S2 |
| Molecular Weight | 242.31800 |
| Flash Point | 243.6ºC |
| Exact Mass | 242.01800 |
| PSA | 111.07000 |
| LogP | 2.61110 |
| Index of Refraction | 1.694 |
| InChIKey | UGZYFXMSMFMTSM-UHFFFAOYSA-N |
| SMILES | CCC(=O)Nc1c2sscc-2n(C)c1=O |
| propionopyrrothine |
| Aureothricin |
| Anzeothricin |
| 4-methyl-6-propionylamino-4H-[1,2]dithiolo[4,3-b]pyrrol-5-one |
| N-(4-methyl-5-oxo-4,5-dihydro-[1,2]dithiolo[4,3-b]pyrrol-6-yl)-propionamide |
| N-(4-Methyl-5-oxo-4,5-dihydro-[1,2]dithiolo[4,3-b]pyrrol-6-yl)-propionamid |
| Farcinicin |
| Propiopyvothine |
| Aurethricin |