(10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate
(10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate structure
|
Common Name | (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 57504-09-3 | Molecular Weight | 290.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (10-Methylanthracen-9-yl)methyl 2-methylprop-2-enoate, CAS号57504-09-3, molecular formula C20H18O2, molecular weight 290.35600, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H18O2 |
|---|---|
| Molecular Weight | 290.35600 |
| Exact Mass | 290.13100 |
| PSA | 26.30000 |
| LogP | 4.92070 |
| InChIKey | KWXRJCHEYQJZBG-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCc1c2ccccc2c(C)c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methacrylsaeure-10-methyl-9-anthrylmethylester |
| 9-Methacryloyloxymethyl-10-methylanthrazen |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate? |
| A: Polar surface area (PSA) of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate is 26.30000. |
| Q: What is the molecular formula of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate? |
| A: Molecular formula of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate is C20H18O2. |
| Q: What is the InChIKey of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate? |
| A: InChIKey of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate is KWXRJCHEYQJZBG-UHFFFAOYSA-N. |
| Q: What is the English name of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate? |
| A: The English name of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate is (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate. |
| Q: What English synonyms does (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate have? |
| A: English synonyms of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate: Methacrylsaeure-10-methyl-9-anthrylmethylester, 9-Methacryloyloxymethyl-10-methylanthrazen. |
| Q: What is the CAS number of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate? |
| A: CAS number of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate is 57504-09-3. |
| Q: What is the LogP of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate? |
| A: LogP of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate is 4.92070. |
| Q: What is the SMILES notation of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate? |
| A: SMILES notation of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate is C=C(C)C(=O)OCc1c2ccccc2c(C)c2ccccc12. |
| Q: What is the Chinese name of 57504-09-3? |
| A: Chinese name of 57504-09-3 is 57504-09-3. |
| Q: What are the upstream materials of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate? |
| A: Related upstream materials(CAS) of (10-methylanthracen-9-yl)methyl 2-methylprop-2-enoate: 7072-00-6;71339-55-4;920-46-7. |