Ethanone,1-[1,1'-biphenyl]-4-yl-, hydrazone structure
|
Common Name | Ethanone,1-[1,1'-biphenyl]-4-yl-, hydrazone | ||
|---|---|---|---|---|
| CAS Number | 5758-19-0 | Molecular Weight | 210.27400 | |
| Density | 1.04g/cm3 | Boiling Point | 368ºC at 760 mmHg | |
| Molecular Formula | C14H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.3ºC | |
| Name | 1-(4-phenylphenyl)ethylidenehydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 368ºC at 760 mmHg |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.27400 |
| Flash Point | 176.3ºC |
| Exact Mass | 210.11600 |
| PSA | 38.38000 |
| LogP | 3.73660 |
| Index of Refraction | 1.576 |
| InChIKey | HDDXXLBVPQVLQK-LFIBNONCSA-N |
| SMILES | CC(=NN)c1ccc(-c2ccccc2)cc1 |
|
~%
Ethanone,1-[1,1... CAS#:5758-19-0 |
| Literature: Newkome,G.R.; Fishel,D.L. Journal of Organic Chemistry, 1966 , vol. 31, p. 677 - 681 |
|
~%
Ethanone,1-[1,1... CAS#:5758-19-0 |
| Literature: Newkome,G.R.; Fishel,D.L. Journal of Organic Chemistry, 1966 , vol. 31, p. 677 - 681 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Phenyl-acetophenon-hydrazon |
| 4-Phenylacetophenonbenzoylhydrazon |
| 2(1H)-Quinazolinone,4-phenyl-6-(trifluoromethoxy) |
| 4-phenyl-6-trifluoromethoxy-1H-quinazolin-2-one |