4-Acetylbiphenyl structure
|
Common Name | 4-Acetylbiphenyl | ||
|---|---|---|---|---|
| CAS Number | 92-91-1 | Molecular Weight | 196.245 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 326.0±11.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O | Melting Point | 152-155 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 139.9±14.2 °C | |
| Name | 4-Acetylbiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.0±11.0 °C at 760 mmHg |
| Melting Point | 152-155 °C(lit.) |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.245 |
| Flash Point | 139.9±14.2 °C |
| Exact Mass | 196.088821 |
| PSA | 17.07000 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | QCZZSANNLWPGEA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(-c2ccccc2)cc1 |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DI0887010 |
| HS Code | 29143900 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Inactivation of cytochrome P450s 2B1, 2B4, 2B6, and 2B11 by arylalkynes.
Drug Metab. Dispos. 25(11) , 1242-8, (1997) The time-dependent loss of the 7-ethoxy-4-trifluoromethylcoumarin (EFC) O-deethylase activity of rat P450 2B1, rabbit P450 2B4, or dog P450 2B11 by 1-ethynylnaphthalene (1EN), 2-ethynylnaphthalene (2E... |
|
|
Synthesis, Characterization and Antifungal Activity of Some Transition Metal Complexes of the Schiff Base Derived from 4-Acetylbi-Phenyl and S-Benzyldithiocarbazate. Bi S and Li G.
Synth. React. Inorg. Met.-Org. Chem. 29(10) , 1829-1841, (1999)
|
| 1-(4-Biphenylyl)ethanone |
| p-phenylacetophenone |
| 4-Biphenylcarboxaldehyde |
| 1-(1,1'-biphenyl-4-yl)ethanone |
| Acetodiphenyl |
| methyl 4-biphenyl ketone |
| 1-(biphenyl-4-yl)ethanone |
| p-Acetylbiphenyl |
| EINECS 202-202-6 |
| 4-acetyl-biphenyl |
| MESITOIC ACID |
| 1-(Biphenyl-4-yl)ethanon |
| ACETYLBIPHENYL |
| MFCD00002481 |
| Ethanone, 1-[1,1'-biphenyl]-4-yl- |
| AURORA KA-7298 |
| 4-Acetylbiphenyl |
| 4-acetylbipheny |
| 4-phenylacetophenone |
| TMBA |