ethyl 4-acetamido-1-benzylpiperidine-4-carboxylate structure
|
Common Name | ethyl 4-acetamido-1-benzylpiperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 57611-91-3 | Molecular Weight | 304.38400 | |
| Density | 1.14g/cm3 | Boiling Point | 457.7ºC at 760 mmHg | |
| Molecular Formula | C17H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.6ºC | |
| Name | ethyl 4-acetamido-1-benzylpiperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 457.7ºC at 760 mmHg |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.38400 |
| Flash Point | 230.6ºC |
| Exact Mass | 304.17900 |
| PSA | 62.13000 |
| LogP | 2.49860 |
| Index of Refraction | 1.552 |
| InChIKey | XXICPKDKEPPEPK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(NC(C)=O)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-acetylamino-1-benzyl-piperidine-4-carboxylic acid ethyl ester |