Spiro[5.5]undecane-3-carboxamide,N-[(4-methylphenyl)sulfonyl]-2,4-dioxo structure
|
Common Name | Spiro[5.5]undecane-3-carboxamide,N-[(4-methylphenyl)sulfonyl]-2,4-dioxo | ||
|---|---|---|---|---|
| CAS Number | 57641-80-2 | Molecular Weight | 377.45500 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H23NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methylphenyl)sulfonyl-2,4-dioxospiro[5.5]undecane-3-carboxamide |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.45500 |
| Exact Mass | 377.13000 |
| PSA | 105.76000 |
| LogP | 3.77030 |
| Index of Refraction | 1.589 |
| InChIKey | IAIUMVPEFJQUIS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C2C(=O)CC3(CCCCC3)CC2=O)cc1 |
|
~%
Spiro[5.5]undec... CAS#:57641-80-2 |
| Literature: Mead Johnson and Company Patent: US3998879 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |