3,4-dinitrophenol structure
|
Common Name | 3,4-dinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 577-71-9 | Molecular Weight | 184.10600 | |
| Density | 1.65g/cm3 | Boiling Point | 418.7ºC at 760mmHg | |
| Molecular Formula | C6H4N2O5 | Melting Point | 130-135ºC | |
| MSDS | Chinese USA | Flash Point | 194.1ºC | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 3,4-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 418.7ºC at 760mmHg |
| Melting Point | 130-135ºC |
| Molecular Formula | C6H4N2O5 |
| Molecular Weight | 184.10600 |
| Flash Point | 194.1ºC |
| Exact Mass | 184.01200 |
| PSA | 111.87000 |
| LogP | 2.25500 |
| Index of Refraction | 1.66 |
| InChIKey | AKLOLDQYWQAREW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)cc1[N+](=O)[O-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H331-H373-H411 |
| Precautionary Statements | P261-P273-P280-P301 + P310-P311 |
| Hazard Codes | T;N |
| Risk Phrases | R23/24/25;R33;R51/53 |
| Safety Phrases | S28;S37;S45;S61 |
| RIDADR | UN 1320 |
| Hazard Class | 4.1 |
| HS Code | 2908999090 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Agonist activity at GPR35 in human U2OS cells assessed as induction of beta-arrestin ...
Source: ChEMBL
Target: G-protein coupled receptor 35
External Id: CHEMBL3391253
|
|
Name: Agonist activity at GPR35 in human HT-29 cells assessed as induction of whole cell dy...
Source: ChEMBL
Target: G-protein coupled receptor 35
External Id: CHEMBL3391240
|
|
Name: Agonist activity at GPR35 in human HT-29 cells assessed as induction of whole cell dy...
Source: ChEMBL
Target: G-protein coupled receptor 35
External Id: CHEMBL3391245
|
|
Name: Agonist activity at GPR35 in human HT-29 cells assessed as induction of whole cell dy...
Source: ChEMBL
Target: G-protein coupled receptor 35
External Id: CHEMBL3391252
|
|
Name: Agonist activity at GPR35 in human U2OS cells assessed as induction of beta-arrestin ...
Source: ChEMBL
Target: G-protein coupled receptor 35
External Id: CHEMBL3391251
|
| 3,4-Dinitrofenol |
| 3,4-DNP |
| 3,4-Dinitrofenol [Czech] |
| 6,5-Dinitrophenol |
| 3.4-Dinitro-1-hydroxy-benzol |
| 3,4-DINITROPHENOL |
| 3,4-dinitro-phenol |
| EINECS 209-415-3 |
| MFCD00143065 |
| 3,4-dinitophenol |
| Phenol,3,4-dinitro |