3-Hydroxyflavone structure
|
Common Name | 3-Hydroxyflavone | ||
|---|---|---|---|---|
| CAS Number | 577-85-5 | Molecular Weight | 238.23800 | |
| Density | 1.367 g/cm3 | Boiling Point | 393.7ºC at 760 mmHg | |
| Molecular Formula | C15H10O3 | Melting Point | 171-172 °C(lit.) | |
| MSDS | N/A | Flash Point | 151.5ºC | |
| Name | flavonol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367 g/cm3 |
|---|---|
| Boiling Point | 393.7ºC at 760 mmHg |
| Melting Point | 171-172 °C(lit.) |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.23800 |
| Flash Point | 151.5ºC |
| Exact Mass | 238.06300 |
| PSA | 50.44000 |
| LogP | 3.16560 |
| Index of Refraction | 1.679 |
| InChIKey | HVQAJTFOCKOKIN-UHFFFAOYSA-N |
| SMILES | O=c1c(O)c(-c2ccccc2)oc2ccccc12 |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | 3152.0 |
| WGK Germany | 3 |
| RTECS | LK8650000 |
| Hazard Class | 9.0 |
| HS Code | 2932999099 |
3-Hydroxyflavone CAS#:577-85-5 ~%
3-Hydroxyflavone CAS#:577-85-5 |
| Literature: Journal of Physical Chemistry, , vol. 91, # 11 p. 2856 - 2861 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Luminescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: mu-type opioid receptor isoform MOR-1 [Homo sapiens]
External Id: OPRM1-OPRD1_AG_LUMI_1536_1X%ACT PRUN
|
|
Name: Antioxidant activity assessed as inhibition of DPPH radical production at 33 uM after...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3056854
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: Inhibition of FabI at 100 uM
Source: ChEMBL
Target: Enoyl-acyl-carrier protein reductase
External Id: CHEMBL859175
|
|
Name: Inhibition of FabG at 100 uM
Source: ChEMBL
Target: 3-oxoacyl-acyl-carrier protein reductase
External Id: CHEMBL859176
|
|
Name: Inhibition of 12-hLO
Source: ChEMBL
Target: Polyunsaturated fatty acid lipoxygenase ALOX12
External Id: CHEMBL924094
|
|
Name: Inhibition of 15-hLO1
Source: ChEMBL
Target: Polyunsaturated fatty acid lipoxygenase ALOX15
External Id: CHEMBL924095
|
|
Name: Antiplasmodial activity against chloroquine-sensitive Plasmodium falciparum NF54
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL859172
|
| FLAVONE,3-HYDROXY |
| EINECS 209-416-9 |
| Flavon-3-ol |
| 2-phenyl-6-hydroxy-4-benzopyrone |
| 4H-1-Benzopyran-4-one,3-hydroxy-2-phenyl |
| 2-phenyl-3-hydroxy-4-oxo-4H-1-benzopyran |
| 3-OH-flavone |
| Flavonol |
| MFCD00006832 |
| 3-hydroxy-2-phenylchromen-4-one |
| 3-Hydroxyflavone |