4-amino-3-chloro-5-nitrobenzotrifluoride
4-amino-3-chloro-5-nitrobenzotrifluoride structure
|
Common Name | 4-amino-3-chloro-5-nitrobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 57729-79-0 | Molecular Weight | 240.56700 | |
| Density | 1.614g/cm3 | Boiling Point | 257.6ºC at 760mmHg | |
| Molecular Formula | C7H4ClF3N2O2 | Melting Point | 65-69 °C | |
| MSDS | Chinese USA | Flash Point | 109.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-6-nitro-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.614g/cm3 |
|---|---|
| Boiling Point | 257.6ºC at 760mmHg |
| Melting Point | 65-69 °C |
| Molecular Formula | C7H4ClF3N2O2 |
| Molecular Weight | 240.56700 |
| Flash Point | 109.6ºC |
| Exact Mass | 239.99100 |
| PSA | 71.84000 |
| LogP | 3.95360 |
| Index of Refraction | 1.542 |
| InChIKey | JLWRJMVXRUKFPA-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(C(F)(F)F)cc1[N+](=O)[O-] |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,Xn |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HS Code | 2921420090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
4-amino-3-chlor... CAS#:57729-79-0 |
| Literature: Collins; McFarlane; Mackie; Smith Tetrahedron, 1992 , vol. 48, # 37 p. 7887 - 7898 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:401-93-4
CAS#:132915-80-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-chloro-2-nitro-4-(trifluoromethyl)phenylamine |
| MFCD00042153 |
| 2-chloro-6-nitro-4-trifluoromethylaniline |
| 4-Amino-3-chloro-5-nitrobenzotrifluoride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: Related upstream materials(CAS) of 2-chloro-6-nitro-4-(trifluoromethyl)aniline: 101646-02-0. |
| Q: What is the molecular weight of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: Molecular weight of 2-chloro-6-nitro-4-(trifluoromethyl)aniline is 240.56700. |
| Q: What is the English name of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: The English name of 2-chloro-6-nitro-4-(trifluoromethyl)aniline is 2-chloro-6-nitro-4-(trifluoromethyl)aniline. |
| Q: What is the InChIKey of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: InChIKey of 2-chloro-6-nitro-4-(trifluoromethyl)aniline is JLWRJMVXRUKFPA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: SMILES notation of 2-chloro-6-nitro-4-(trifluoromethyl)aniline is Nc1c(Cl)cc(C(F)(F)F)cc1[N+](=O)[O-]. |
| Q: What are the downstream products of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: Related downstream products(CAS) of 2-chloro-6-nitro-4-(trifluoromethyl)aniline: 401-93-4;132915-80-1. |
| Q: What English synonyms does 2-chloro-6-nitro-4-(trifluoromethyl)aniline have? |
| A: English synonyms of 2-chloro-6-nitro-4-(trifluoromethyl)aniline: 6-chloro-2-nitro-4-(trifluoromethyl)phenylamine, MFCD00042153, 2-chloro-6-nitro-4-trifluoromethylaniline, 4-Amino-3-chloro-5-nitrobenzotrifluoride. |
| Q: What is the melting point of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: Melting point of 2-chloro-6-nitro-4-(trifluoromethyl)aniline is 65-69 °C. |
| Q: What is the molecular formula of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: Molecular formula of 2-chloro-6-nitro-4-(trifluoromethyl)aniline is C7H4ClF3N2O2. |
| Q: What is the boiling point of 2-chloro-6-nitro-4-(trifluoromethyl)aniline? |
| A: Boiling point of 2-chloro-6-nitro-4-(trifluoromethyl)aniline is 257.6ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |