4-amino-3-chloro-5-nitrobenzotrifluoride
Modify Date: 2025-08-20 21:31:53
4-amino-3-chloro-5-nitrobenzotrifluoride structure
|
Common Name | 4-amino-3-chloro-5-nitrobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 57729-79-0 | Molecular Weight | 240.56700 | |
| Density | 1.614g/cm3 | Boiling Point | 257.6ºC at 760mmHg | |
| Molecular Formula | C7H4ClF3N2O2 | Melting Point | 65-69 °C | |
| MSDS | Chinese USA | Flash Point | 109.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-chloro-6-nitro-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.614g/cm3 |
|---|---|
| Boiling Point | 257.6ºC at 760mmHg |
| Melting Point | 65-69 °C |
| Molecular Formula | C7H4ClF3N2O2 |
| Molecular Weight | 240.56700 |
| Flash Point | 109.6ºC |
| Exact Mass | 239.99100 |
| PSA | 71.84000 |
| LogP | 3.95360 |
| Index of Refraction | 1.542 |
| InChIKey | JLWRJMVXRUKFPA-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(C(F)(F)F)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,Xn |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HS Code | 2921420090 |
|
~93%
4-amino-3-chlor... CAS#:57729-79-0 |
| Literature: Collins; McFarlane; Mackie; Smith Tetrahedron, 1992 , vol. 48, # 37 p. 7887 - 7898 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:401-93-4
CAS#:132915-80-1| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6-chloro-2-nitro-4-(trifluoromethyl)phenylamine |
| MFCD00042153 |
| 2-chloro-6-nitro-4-trifluoromethylaniline |
| 4-Amino-3-chloro-5-nitrobenzotrifluoride |