Cbz-L-Glu(Ome)-OtBu
Cbz-L-Glu(Ome)-OtBu structure
|
Common Name | Cbz-L-Glu(Ome)-OtBu | ||
|---|---|---|---|---|
| CAS Number | 57732-63-5 | Molecular Weight | 351.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H25NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate (Cbz-L-Glu(Ome)-OtBu), CAS号 57732-63-5, molecular formula C18H25NO6, molecular weight 351.39400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H25NO6 |
|---|---|
| Molecular Weight | 351.39400 |
| Exact Mass | 351.16800 |
| PSA | 90.93000 |
| LogP | 2.96720 |
| InChIKey | TWPGMFKIQWDGKB-AWEZNQCLSA-N |
| SMILES | COC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:24277-39-2
CAS#:5891-45-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-CBZ-5-methyl-t-butyl glutamate |
| α-t-butyl γ-methyl N-Z-(S)-glutamate |
| α-tert-butyl γ-methyl N-(benzyloxycarbonyl)-L-glutamate |
| α-t-butyl γ-methyl N-Z-glutamate |
| 4(S)-t-butoxycarbonyl-4-(N-benzyloxycarbonylamino)butyric acid methyl ester |
| N-Benzyloxycarbonyl-L-glutaminsaeure-α-tert.-butylester-γ-methylester |
| Cbz-L-Glu(Ome)-OtBu |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: InChIKey of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate is TWPGMFKIQWDGKB-AWEZNQCLSA-N. |
| Q: What is the LogP of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: LogP of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate is 2.96720. |
| Q: What English synonyms does 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate have? |
| A: English synonyms of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate: N-CBZ-5-methyl-t-butyl glutamate, α-t-butyl γ-methyl N-Z-(S)-glutamate, α-tert-butyl γ-methyl N-(benzyloxycarbonyl)-L-glutamate, α-t-butyl γ-methyl N-Z-glutamate, 4(S)-t-butoxycarbonyl-4-(N-benzyloxycarbonylamino)butyric acid methyl ester, N-Benzyloxycarbonyl-L-glutaminsaeure-α-tert.-butylester-γ-methylester, Cbz-L-Glu(Ome)-OtBu. |
| Q: What are the downstream products of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: Related downstream products(CAS) of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate: 24277-39-2;5891-45-2. |
| Q: What is the SMILES notation of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: SMILES notation of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate is COC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C. |
| Q: What is the polar surface area (PSA) of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: Polar surface area (PSA) of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate is 90.93000. |
| Q: What is the English name of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: The English name of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate is 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate. |
| Q: What is the molecular formula of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: Molecular formula of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate is C18H25NO6. |
| Q: What is the molecular weight of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: Molecular weight of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate is 351.39400. |
| Q: What is the CAS number of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate? |
| A: CAS number of 1-tert-butyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate is 57732-63-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |