2H-Indol-2-one,5-bromo-1,3-dihydro-3-[(4-methoxyphenyl)imino]- structure
|
Common Name | 2H-Indol-2-one,5-bromo-1,3-dihydro-3-[(4-methoxyphenyl)imino]- | ||
|---|---|---|---|---|
| CAS Number | 57743-22-3 | Molecular Weight | 331.16400 | |
| Density | 1.55g/cm3 | Boiling Point | 412.3ºC at 760 mmHg | |
| Molecular Formula | C15H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.2ºC | |
| Name | 5-bromo-3-(4-methoxyanilino)indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 412.3ºC at 760 mmHg |
| Molecular Formula | C15H11BrN2O2 |
| Molecular Weight | 331.16400 |
| Flash Point | 203.2ºC |
| Exact Mass | 330.00000 |
| PSA | 50.69000 |
| LogP | 3.66860 |
| Index of Refraction | 1.67 |
| InChIKey | WGAFLWYXQOACCE-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C2C(=O)Nc3ccc(Br)cc32)cc1 |
|
~23%
2H-Indol-2-one,... CAS#:57743-22-3 |
| Literature: Sridhar, Seshaiah Krishnan; Ramesh, Atmakuru Biological and Pharmaceutical Bulletin, 2001 , vol. 24, # 10 p. 1149 - 1152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms1662i18 |