Deslorelin structure
|
Common Name | Deslorelin | ||
|---|---|---|---|---|
| CAS Number | 57773-65-6 | Molecular Weight | 1282.450 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 1783.4ºC at 760 mmHg | |
| Molecular Formula | C64H83N17O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1032.4ºC | |
Use of DeslorelinDeslorelin is a GnRH agonist. Deslorelin implants can be used as an alternative to dopamine agonists to induce fertil eoestrus in the bitch in anoestrus. The deslorelin implant can be used successfully in the queen for oestrus inhibition. Deslorelin acetate did not significantly affect the spontaneous contraction amplitude but caused a decrease in the frequency in the dorsal and ventral parts of the bladder. |
| Name | Deslorelin |
|---|---|
| Synonym | More Synonyms |
| Description | Deslorelin is a GnRH agonist. Deslorelin implants can be used as an alternative to dopamine agonists to induce fertil eoestrus in the bitch in anoestrus. The deslorelin implant can be used successfully in the queen for oestrus inhibition. Deslorelin acetate did not significantly affect the spontaneous contraction amplitude but caused a decrease in the frequency in the dorsal and ventral parts of the bladder. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 1783.4ºC at 760 mmHg |
| Molecular Formula | C64H83N17O12 |
| Molecular Weight | 1282.450 |
| Flash Point | 1032.4ºC |
| Exact Mass | 1281.640747 |
| PSA | 444.83000 |
| LogP | 0.77 |
| Index of Refraction | 1.710 |
| InChIKey | GJKXGJCSJWBJEZ-XRSSZCMZSA-N |
| SMILES | CCNC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1cnc[nH]1)NC(=O)C1CCC(=O)N1 |
| Storage condition | −20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R60 |
| Safety Phrases | 53-22-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | OK6755000 |
|
Name: Human GnRH1 receptor (Gonadotrophin-releasing hormone receptors)
Source: IUPHAR-DB
Target: GnRH1 receptor (Gonadotrophin-releasing hormone receptors) [Homo sapiens]
External Id: 256_Human
|
|
Name: Clearance in rat after iv dose (100 ug/kg)
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL626121
|
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: S16 Schwann cell PMP22 intronic element firefly luciferase assay
Source: NCGC
Target: peripheral myelin protein 22 [Rattus norvegicus]
External Id: cmt-p4-fluc-fda_regid
|
|
Name: The basic principle of this assay is explained in (Schiele et al., 2014). Prior to ea...
Source: ChEMBL
Target: Gonadotropin-releasing hormone receptor
External Id: CHEMBL3885781
|
|
Name: qHTS for Inhibitors of Polymerase Kappa
Source: NCGC
Target: DNA polymerase kappa [Homo sapiens]
External Id: PolK100
|
|
Name: In vitro binding affinity for rat pituitary LHRH receptor, activity is expressed as p...
Source: ChEMBL
Target: Gonadotropin-releasing hormone receptor
External Id: CHEMBL712411
|
|
Name: Induction of luteinizing hormone release in ovariectomized estrogen/progesterone-trea...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3283065
|
|
Name: Tested in vitro for LH release from cultured rat pituitary cells, activity is express...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL798093
|
| Deslorelin |
| deslorelin acetate |
| (D-trp6-pro9-NEt)-Gonadotropin Releasing Hormone |
| Bachem 9022 |
| 5-Oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-tryptophyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide |
| [des-Gly10, D-Trp6]-LH-RH ethylamide |
| MFCD00167401 |
| D-Trp6-pro9-N-ethylamide-LHRH |
| 6-D-Tryptophan-9-(N-ethyl-L-prolinamide)-10-deglycinamide Luteinizing Hormone-releasing Factor (pig) |
| tryptal |
| Delorelin acetate |
| DESORELIN |
| bachem9022 |
| mide)-10-deglycinamide |
| somagard |