1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene
![1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene Structure](https://image.chemsrc.com/caspic/254/57787-10-7.png)
1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene structure
|
Common Name | 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 57787-10-7 | Molecular Weight | 297.11500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15Cl2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15Cl2O3P |
|---|---|
| Molecular Weight | 297.11500 |
| Exact Mass | 296.01400 |
| PSA | 45.34000 |
| LogP | 4.84350 |
| InChIKey | MWNCBFROEFSYSB-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(Cl)c1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
1-chloro-4-[chl... CAS#:57787-10-7 |
| Literature: Iorga, Bogdan; Eymery, Frederic; Savignac, Philippe Tetrahedron Letters, 1998 , vol. 39, # 22 p. 3693 - 3696 |
|
~87%
1-chloro-4-[chl... CAS#:57787-10-7 |
| Literature: Wu, Di; He, Yanhong; Tang, Rongchang; Guan, Zhi Synlett, 2009 , # 13 p. 2180 - 2182 |
|
~%
1-chloro-4-[chl... CAS#:57787-10-7 |
| Literature: Petrova,J. et al. Synthesis, 1975 , p. 658 - 660 |
|
~%
1-chloro-4-[chl... CAS#:57787-10-7 |
| Literature: Iorga, Bogdan; Eymery, Frederic; Savignac, Philippe Tetrahedron, 1999 , vol. 55, # 9 p. 2671 - 2686 |
|
~%
1-chloro-4-[chl... CAS#:57787-10-7 |
| Literature: Wu, Di; He, Yanhong; Tang, Rongchang; Guan, Zhi Synlett, 2009 , # 13 p. 2180 - 2182 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 57787-10-7? |
| A: Chinese name of 57787-10-7 is 57787-10-7. |
| Q: What are the upstream materials of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: Related upstream materials(CAS) of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene: 108054-54-2;39225-17-7;104-83-6;104-88-1. |
| Q: What is the SMILES notation of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: SMILES notation of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene is CCOP(=O)(OCC)C(Cl)c1ccc(Cl)cc1. |
| Q: What is the molecular formula of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: Molecular formula of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene is C11H15Cl2O3P. |
| Q: What is the polar surface area (PSA) of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: Polar surface area (PSA) of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene is 45.34000. |
| Q: What is the CAS number of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: CAS number of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene is 57787-10-7. |
| Q: What is the LogP of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: LogP of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene is 4.84350. |
| Q: What is the English name of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: The English name of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene is 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene. |
| Q: What is the InChIKey of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: InChIKey of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene is MWNCBFROEFSYSB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene? |
| A: Molecular weight of 1-chloro-4-[chloro(diethoxyphosphoryl)methyl]benzene is 297.11500. |