2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile
2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile structure
|
Common Name | 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 577993-30-7 | Molecular Weight | 342.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H18N2O2 |
|---|---|
| Molecular Weight | 342.39100 |
| Exact Mass | 342.13700 |
| PSA | 57.24000 |
| LogP | 4.51068 |
| InChIKey | HJHOODSEYWRRLC-UHFFFAOYSA-N |
| SMILES | N#Cc1c(N2CCCC2)cc(-c2ccc(-c3ccccc3)cc2)oc1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: LogP of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile is 4.51068. |
| Q: What is the Chinese name of 577993-30-7? |
| A: Chinese name of 577993-30-7 is 577993-30-7. |
| Q: What is the InChIKey of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: InChIKey of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile is HJHOODSEYWRRLC-UHFFFAOYSA-N. |
| Q: What is the English name of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: The English name of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile is 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile. |
| Q: What is the CAS number of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: CAS number of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile is 577993-30-7. |
| Q: What is the polar surface area (PSA) of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: Polar surface area (PSA) of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile is 57.24000. |
| Q: What is the molecular weight of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: Molecular weight of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile is 342.39100. |
| Q: What is the molecular formula of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: Molecular formula of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile is C22H18N2O2. |
| Q: What are the upstream materials of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: Related upstream materials(CAS) of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile: 123-75-1. |
| Q: What is the SMILES notation of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile? |
| A: SMILES notation of 2-oxo-6-(4-phenylphenyl)-4-pyrrolidin-1-ylpyran-3-carbonitrile is N#Cc1c(N2CCCC2)cc(-c2ccc(-c3ccccc3)cc2)oc1=O. |