Methanone,(3-chlorophenyl)(2,4-dimethylphenyl)- structure
|
Common Name | Methanone,(3-chlorophenyl)(2,4-dimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 57800-68-7 | Molecular Weight | 244.71600 | |
| Density | 1.154g/cm3 | Boiling Point | 360.6ºC at 760mmHg | |
| Molecular Formula | C15H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.6ºC | |
| Name | (3-chlorophenyl)-(2,4-dimethylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 360.6ºC at 760mmHg |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.71600 |
| Flash Point | 205.6ºC |
| Exact Mass | 244.06500 |
| PSA | 17.07000 |
| LogP | 4.18780 |
| Index of Refraction | 1.58 |
| InChIKey | COFUWPXPXNYUOV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2cccc(Cl)c2)c(C)c1 |
|
~%
Methanone,(3-ch... CAS#:57800-68-7 |
| Literature: Newman; Scheurer Journal of the American Chemical Society, 1956 , vol. 78, p. 5004,5006 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-CHLORO-2',4'-DIMETHOXYPROPIOPHENONE |
| 3'-chloro-2,4-dimethyl-benzophenone |
| Propiophenone,3-chloro-2',4'-dimethoxy-(8CI) |
| 3-Chlor-2',4'-dimethyl-benzophenon |
| 1-Propanone,3-chloro-1-(2,4-dimethoxyphenyl) |
| 3-Chlor-2',4'-dimethoxypropiophenon |
| 2,4-Dimethyl-3'-chlorobenzophenon |