2-Pentanone,5-(3-methoxyphenyl)-1-(methylsulfinyl)- structure
|
Common Name | 2-Pentanone,5-(3-methoxyphenyl)-1-(methylsulfinyl)- | ||
|---|---|---|---|---|
| CAS Number | 57816-02-1 | Molecular Weight | 254.34500 | |
| Density | 1.161g/cm3 | Boiling Point | 457.5ºC at 760 mmHg | |
| Molecular Formula | C13H18O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.5ºC | |
| Name | 5-(3-methoxyphenyl)-1-methylsulfinylpentan-2-one |
|---|
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 457.5ºC at 760 mmHg |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.34500 |
| Flash Point | 230.5ºC |
| Exact Mass | 254.09800 |
| PSA | 62.58000 |
| LogP | 2.83120 |
| Index of Refraction | 1.551 |
| InChIKey | DPPTVWYLKDMCQY-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCCC(=O)CS(C)=O)c1 |
|
~%
2-Pentanone,5-(... CAS#:57816-02-1 |
| Literature: Kurosawa; Tohma; Oikawa; Yonemitsu Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, # 5 p. 1533 - 1539 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |