6-(3-methoxyphenyl)-2-methyl-2-methylsulfinyl-hexan-3-one structure
|
Common Name | 6-(3-methoxyphenyl)-2-methyl-2-methylsulfinyl-hexan-3-one | ||
|---|---|---|---|---|
| CAS Number | 67617-20-3 | Molecular Weight | 282.39800 | |
| Density | 1.12g/cm3 | Boiling Point | 463.9ºC at 760 mmHg | |
| Molecular Formula | C15H22O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.4ºC | |
| Name | 6-(3-methoxyphenyl)-2-methyl-2-methylsulfinylhexan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 463.9ºC at 760 mmHg |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.39800 |
| Flash Point | 234.4ºC |
| Exact Mass | 282.12900 |
| PSA | 62.58000 |
| LogP | 3.60980 |
| Index of Refraction | 1.54 |
| InChIKey | QNBDCTCSSPBHDM-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCCC(=O)C(C)(C)S(C)=O)c1 |
|
~%
6-(3-methoxyphe... CAS#:67617-20-3 |
| Literature: Kurosawa; Tohma; Oikawa; Yonemitsu Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, # 5 p. 1533 - 1539 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-(3-methoxyphenyl)-2-methyl-2-methylsulfinyl-hexan-3-one |