7-naphthalen-2-yl-4,7-dioxo-heptanoic acid structure
|
Common Name | 7-naphthalen-2-yl-4,7-dioxo-heptanoic acid | ||
|---|---|---|---|---|
| CAS Number | 57877-42-6 | Molecular Weight | 284.30700 | |
| Density | 1.239g/cm3 | Boiling Point | 535.8ºC at 760 mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.9ºC | |
| Name | 7-naphthalen-2-yl-4,7-dioxoheptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 535.8ºC at 760 mmHg |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Flash Point | 291.9ºC |
| Exact Mass | 284.10500 |
| PSA | 71.44000 |
| LogP | 3.23660 |
| Index of Refraction | 1.603 |
| InChIKey | DYCJYDMZSMZGKV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)CCC(=O)c1ccc2ccccc2c1 |
|
~%
7-naphthalen-2-... CAS#:57877-42-6 |
| Literature: Robinson Journal of the Chemical Society, 1938 , p. 1390,1394 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7-(naphthalen-2-yl)-4,7-dioxoheptanoic acid |
| 7-[2]Naphthyl-4,7-dioxo-heptansaeure |
| 7-[2]naphthyl-4,7-dioxo-heptanoic acid |